On Target OPRK_HUMAN 0.475/CHEMBL1773748
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.475, the most similar ligand is CHEMBL1773748. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL1773748 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | COC(=O)[C@@H]1C[C@H](OC(=O)C)C(=O)[C@H]2[C@@]1(C)CC[C@H]3C(=O)O[C@@H](C[C@]23C)C4=CC5OC4C(=C5C(=O)OC)C(=O)OC |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 00050042 81000000 00000100 80090380 803c0040 00200800 02000080 0a000402 01000000 01120000 40000000 4000d001 14028028 02800000 00000400 00081008 00820010 80000100 33612010 02022001 00000021 10000a80 01008000 00000814 00201400 00001400 00404000 80000000 00000202 8000000a 24020000 02800010 |