On Target AOFB_HUMAN 0.36196318/CHEMBL4062286
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.36196318, the most similar ligand is CHEMBL4062286. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL4062286 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | COc1c(OC\C=C(/C)\C[C@H]2OC(=O)C(=C2)CCC(=O)N)ccc3C=CC(=O)Oc13 |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 0c050040 01200028 20080108 00210700 001d1214 00400820 02000080 68000602 130a4000 401208c0 40000200 40419000 4682c432 01200080 01000485 02089009 00820010 00000040 08410010 02028003 00040020 18001e88 0120a008 00180010 08601500 00000400 00406011 88100000 06042200 8106080a 04000000 00800010 |