On Target NMDE2_HUMAN 0.147651/CHEMBL219114
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.147651, the most similar ligand is CHEMBL219114. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL219114 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | O=C(OCCc1ccccc1)N2CCC(CNc3ncccn3)CC2 |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 00000002 01401000 00100100 00010600 00000040 0000c000 00002000 20100040 00200300 200808c0 08200004 50038000 00008002 00000100 00040000 001e000c 08020000 02084000 04400800 00a00201 00000000 1c040c50 21800840 00500018 00000000 80041002 00000000 10200000 00000208 00460803 c0001000 00000680 |