On Target GRM5_HUMAN 0.19745223/CHEMBL3086720
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.19745223, the most similar ligand is CHEMBL3086720. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL3086720 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | COC(=O)N1CCC2(CC1)CC(O)(CO2)C#Cc3cccc(C)c3 |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 00000240 01025000 00100902 00090700 00482001 00008000 00200000 20000000 00000200 010008c0 00240080 5001c008 00008082 01881000 00080000 001b9008 00220200 82080000 01c02000 00000201 00000028 19940d50 05000881 0a500019 00000405 8004000a 00000000 10000020 00000208 00064201 80000804 00000200 |