On Target P2RX3_HUMAN 0.20476191/CHEMBL3679736
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.20476191, the most similar ligand is CHEMBL3679736. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL3679736 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | CCOC(=O)C(C)(C)C(=O)C1C(N(C(=O)C1=O)c2ccc(cc2)c3csc(C)c3)c4ccccc4OC |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 0003e002 01801808 2010090a 00010700 201c1000 00202110 46000080 22001680 04100d00 001a08c0 08380204 5001f0c0 1e00883a 01b08001 81023641 00083008 00860000 02001009 0c402018 00020201 c0100120 58068e90 31012000 00500418 02801c00 c4100080 00000000 900000c5 0000c302 00064003 24045000 00c10600 |