On Target MDR1_HUMAN 0.5425532/CHEMBL2074838
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.5425532, the most similar ligand is CHEMBL2074838. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL2074838 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | CCCCCC(O)CCCCC(O)C1CCC(O1)C2CCC(O2)C(O)CCCCCCCCCCC3=CC(C)OC3=O |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 00010040 01000000 00000000 00010300 00180000 00000800 02000000 08000442 01002000 00100000 40000000 40009000 04028008 02800000 00080400 000a9008 00820010 00000000 00412010 00000001 00000020 00000a80 05008000 08000010 00201400 00000400 00404000 80000020 00000200 00000000 24020000 00800010 |