On Target AGTR2_HUMAN 0.172/CHEMBL1668009
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.172, the most similar ligand is CHEMBL1668009. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL1668009 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | CCCCc1nc(Cl)c2C(=CCC(c3ccc(cc3)c4ccccc4c5nnn[nH]5)n12)C(=O)O |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 0001a04a 05800219 40501500 13110610 040800c4 0c0a0008 810823a4 38181500 91600904 181838da 28108008 40019a00 86029888 00b00002 a10b0082 000c204c 10028000 0e400840 24490018 50010003 84060500 18008b80 31208060 81414410 01045000 c2200700 90440001 900096c0 84084004 00c6080a c40c7284 28030402 |