On Target OPRM_MOUSE 0.252809/CHEMBL405663
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.252809, the most similar ligand is CHEMBL405663. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL405663 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | CC(C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](C)NC(=O)[C@@H](N)Cc2ccc(O)cc2)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](CO)C(=O)OC[C@H]3O[C@H](O)[C@H](O)[C@@H](O)[C@@H]3O |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 00060040 01007208 20100508 84810700 803800c0 00000000 02002800 2000004c 00002880 010808e0 08300000 4000b000 1e008002 02802001 80181008 002f9008 10820000 02000001 11c02018 00020201 00000120 38300e00 17000083 8b400018 10001c01 80000000 00920000 30000021 0c000202 0006000b 20a04000 00802e00 |