On Target P2Y12_HUMAN 0.22457626/CHEMBL256251
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.22457626, the most similar ligand is CHEMBL256251. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL256251 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | CCNC(=O)Nc1ncnc2c1ncn2[C@@H]3O[C@H](CC(=O)O)[C@H]4O[C@@H](O[C@@H]34)\C=C\c5ccccc5 |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 0007004e 01c01800 80180100 88c90f20 003c00e0 0020c004 8200bc84 08002c41 00602300 418008f0 4c38802c 40019014 1c009028 02b80100 00081082 103ed00c 00a40420 02404100 b9c0a018 80201001 80180120 18050e50 27824044 0c40003c 11101402 c0000102 00402600 740004f0 0042021a 00460001 c4e80000 000003d0 |