On Target SCN9A_HUMAN 0.23913044/CHEMBL4077213
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.23913044, the most similar ligand is CHEMBL4077213. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL4077213 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | CCCCCCCCCCC1NC(=N)NC2(CCCO2)C1C(=O)O |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 00010040 01401000 00100100 00010d10 001c0040 00200000 00000004 00002000 00000200 01000182 00200000 40019000 1d009008 00884100 00080000 00181008 00a00000 00020000 01c02850 00000001 00000120 12016a14 01000080 00100018 00012402 00001002 40001000 10000000 00000210 00040011 800a0000 00000a00 |