On Target PRGR_HUMAN 0.46391752/CHEMBL3695600
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.46391752, the most similar ligand is CHEMBL3695600. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL3695600 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | C[C@]12CC[C@@H]3[C@H]4CCC(=O)C=C4C[C@@H](C=C)[C@H]3[C@@H]1CC[C@]25OC(=O)C=C5 |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 00050000 01000000 00000100 00010300 00090000 00000000 02000080 08000402 01000000 00108000 00000000 40409000 04028008 00800000 00000400 00081008 00820010 00000020 02412010 00000001 00000020 00000a80 01008000 00000010 00201400 00000400 00404000 80000000 00000200 01000002 24020000 00800010 |