On Target PGH2_HUMAN 0.6972477/CHEMBL463571
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.6972477, the most similar ligand is CHEMBL463571. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL463571 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | C[C@H]1O[C@@]1(C)C(=O)O[C@@H]2[C@@H](OC(=O)C)\C(=C/[C@H]3O[C@H]3[C@]4(C)O[C@@H]4[C@H]5OC(=O)C(=C)[C@H]25)\C(=O)O |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 00050040 81000000 00000d08 80010300 003c00c0 00200800 02000280 28000442 01002000 01100008 40000200 4000d001 1c028028 02800000 00080404 000a9008 00820000 80000100 31412010 0000a001 00000020 10001a80 0500a000 08000014 00201400 00001400 0040e200 80000020 00000200 0000000a 24020000 00800010 |