On Target ACE_HUMAN 0.27173913/CHEMBL128223
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.27173913, the most similar ligand is CHEMBL128223. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL128223 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | OC(=O)[C@@H]1CCC(C1)C(=O)\C=C/S |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 00010000 01000000 00000000 00100000 000c0000 00200800 00000000 00000400 01000400 00120000 40000000 40001000 14008028 00800000 00000400 00080008 00000000 00000000 00402000 00000001 00000000 00000a00 01000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 24020000 00010000 |