On Target 5HT1B_HUMAN 0.16774194/CHEMBL321190
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.16774194, the most similar ligand is CHEMBL321190. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL321190 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | CCCCCCCCC(=O)Oc1ccc2[nH]cc(CCN(C)C)c2c1 |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 04010002 01000808 20100108 41010710 000c1000 02000000 060c2000 00000000 00400000 00090840 08200004 40009000 1480880e 00c00000 11010041 000c200c 00820000 02000000 00602400 00020001 40000000 18208a08 31800000 91400010 00042000 80000000 08120000 00000000 04000200 00060002 00060200 10000620 |