On Target TLR4_HUMAN 0.3642857/CHEMBL4071705
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.3642857, the most similar ligand is CHEMBL4071705. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL4071705 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | C[C@@H](OC(=O)c1ccccc1O)[C@]2(O)CC[C@]3(O)[C@]4(O)CC=C5C[C@@H](O)CC[C@]5(C)[C@H]4C[C@@H](OC(=O)\C=C\c6ccccc6)[C@]23C |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 00040000 81000808 a0000d00 00010300 00280050 00024000 82000080 00000c02 01800100 01100848 40000200 40008000 04028002 02810000 00000406 02083008 00820c00 02000020 3341a018 00022001 00000020 28020a20 05008000 08400014 00201400 80002000 00486000 c0000420 00400200 0102000a e4020000 02000010 |