On Target OPRD_HUMAN 0.37956205/CHEMBL1161423
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.37956205, the most similar ligand is CHEMBL1161423. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL1161423 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | Cc1cc(O)cc(C)c1C[C@H](N)[C@@H](O)C\C=C\[C@H](O)[C@@H](Cc2ccccc2)C(=O)O[C@H](CO)Cc3ccccc3 |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 00000040 c1000008 20000d02 80010700 00000061 00000000 02001000 28000442 10000800 011808c0 08100200 40009000 14028002 00200000 00040424 00089008 08020000 02000000 05402018 02022201 00010120 18000a00 0700c040 89400010 00201c00 80002401 00524000 80000020 04000202 80060002 24000000 00000400 |