On Target CXCR4_HUMAN 0.2952381/CHEMBL1221944
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.2952381, the most similar ligand is CHEMBL1221944. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL1221944 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | C[C@H](OC(=O)C)\C=C/C(=O)N[C@@H]1C[C@H](C)[C@H](C\C=C(/C)\C=C\[C@H]2O[C@@](C)(C[C@@]3(CO3)[C@@H]2O)OCCNC(=O)CCCCCNC(=O)CCCCCNC(=O)CCCC[C@@H]4SC[C@@H]5NC(=O)N[C@H]45)O[C@@H]1C |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 00050050 c704f000 20100800 80910f40 c03801c0 00800801 02103804 28002402 05200000 031040e8 40200200 c0079000 0403910e 02870100 0008140c 0028900c 34821040 00002100 3141a0f0 0000a301 c0102120 30051e90 1740a300 0830001a 10211400 00008c00 00c84200 b4000021 08000242 00040021 24aa0000 07812a10 |