On Target OPRX_HUMAN 0.24038461/CHEMBL3262362
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.24038461, the most similar ligand is CHEMBL3262362. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL3262362 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | CC[C@](O)([C@H]1C[C@]23C=C[C@]1(OC)[C@@H]4Oc5c(O)ccc6C[C@H]2N(CC7CC7)CC[C@@]34c56)C(C)(C)C |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 04001000 cb000208 20100d0a 80310700 00381061 c2000802 02081000 38000643 00002890 011818ca 48300300 51818040 00824002 21a00080 11240425 020ca018 08800200 22008060 17492012 0002a201 00000100 18200010 0500e040 89540410 00201000 c0002401 04524200 90800000 04000302 0007cc0a 24020000 00012f50 |