On Target ESR1_HUMAN 0.30952382/CHEMBL4072205
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.30952382, the most similar ligand is CHEMBL4072205. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL4072205 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | CC(C)CCCCCOC(=O)\C=C\c1ccc(cc1)C(=C2C3CC4CC(CC2C4)C3)c5ccc(O)cc5 |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 00040000 01000008 20000300 00010300 00080000 00000000 82000080 01000400 01800100 00180840 48000000 40008800 04028002 00800000 00000402 00081008 00820400 02000000 2241a018 00020001 01000020 08000a00 01008021 00400010 01001400 a0000000 00526000 c0000400 00400280 00020002 24020000 00000410 |