On Target IKKB_HUMAN 0.5/CHEMBL1253688
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.5, the most similar ligand is CHEMBL1253688. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL1253688 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | O=C(CCc1ccccc1)\C=C\C[C@@H]2CC=CC(=O)O2 |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 00040000 01000000 00000902 00010200 00000000 00000000 02000280 08000402 01000800 00180840 48100200 40009000 04028000 00200000 00000404 00080008 00020000 02000000 20010018 00008001 20000120 08001a80 0100a000 00400010 00201c00 80002400 00406200 80000000 00000200 00020002 04000000 00000410 |