On Target TRPV3_HUMAN 0.20547946/CHEMBL73188
For the given ligand GABAPENTIN, we have found in our database that, being scored 0.20547946, the most similar ligand is CHEMBL73188. Check out the elaboration below.
| GABAPENTIN (Given Ligand) | CHEMBL73188 (Similar Ligand) |
|---|---|
| NCC1(CC(=O)O)CCCCC1 | CC(=O)N[C@@H](C(=O)O)C(C)(C)SN=O |
|
|
|
|
|
|
| 00030000 01000000 00000000 00000400 00180000 00000000 00000000 00000000 00000000 00000080 00000000 40011000 04008008 00800000 00000000 00080008 00000000 00000000 02402000 00000001 00000000 10000a10 01000000 00000010 00000000 00000000 00000000 00000000 00000000 00040000 00020000 00000000 | 00000000 00005000 00100010 00300400 00000080 00000000 00000000 00000000 00000000 02000000 00200400 40003000 06018002 00040280 00000000 00080808 10000000 00000000 00400000 00420301 01800001 90000e00 03000400 04000018 00000400 00000000 00020000 01000008 00102000 00040001 20004000 03010200 |