On Target PPAP_HUMAN 0.05882353/CHEMBL507996
For the given ligand GABAPENTIN, we have found in our database that, being scored 0.05882353, the most similar ligand is CHEMBL507996. Check out the elaboration below.
| GABAPENTIN (Given Ligand) | CHEMBL507996 (Similar Ligand) |
|---|---|
| NCC1(CC(=O)O)CCCCC1 | Cl.COc1ccc(cc1)[C@@H](N[C@H](C)c2ccccc2)P(=O)(O)O |
|
|
|
|
|
|
| 00030000 01000000 00000000 00000400 00180000 00000000 00000000 00000000 00000000 00000080 00000000 40011000 04008008 00800000 00000000 00080008 00000000 00000000 02402000 00000001 00000000 10000a10 01000000 00000010 00000000 00000000 00000000 00000000 00000000 00040000 00020000 00000000 | 00010010 00000608 20000108 00010600 00001000 00400000 06040000 82001000 000000c0 00080840 08200000 40008000 00000802 00020000 8108040d 00000008 00003028 02000000 00000000 00020200 00000000 0d308000 00000000 00400010 00000000 c6010006 00220000 80014000 00000300 30060002 00040000 00028603 |