On Target GRM5_HUMAN 0.7297297/CHEMBL90501
For the given ligand GABAPENTIN, we have found in our database that, being scored 0.7297297, the most similar ligand is CHEMBL90501. Check out the elaboration below.
| GABAPENTIN (Given Ligand) | CHEMBL90501 (Similar Ligand) |
|---|---|
| NCC1(CC(=O)O)CCCCC1 | N[C@]1(CC2CC1[C@H]2C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00030000 01000000 00000000 00000400 00180000 00000000 00000000 00000000 00000000 00000080 00000000 40011000 04008008 00800000 00000000 00080008 00000000 00000000 02402000 00000001 00000000 10000a10 01000000 00000010 00000000 00000000 00000000 00000000 00000000 00040000 00020000 00000000 | 00030000 01000000 00000000 00000400 00180000 00000000 00000000 00000000 00000000 00020080 00000000 40013000 04008038 03800010 00000000 00080008 00000000 00000000 00402000 00000001 00000000 10000a10 03000000 00000010 00000000 00000000 00000000 00000000 00000000 01040000 00020000 00000000 |