On Target PRGR_HUMAN 0.35185185/CHEMBL1162
For the given ligand GABAPENTIN, we have found in our database that, being scored 0.35185185, the most similar ligand is CHEMBL1162. Check out the elaboration below.
| GABAPENTIN (Given Ligand) | CHEMBL1162 (Similar Ligand) |
|---|---|
| NCC1(CC(=O)O)CCCCC1 | C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@H]34)[C@@H]1CC[C@@]2(O)C#C |
|
|
|
|
|
|
| 00030000 01000000 00000000 00000400 00180000 00000000 00000000 00000000 00000000 00000080 00000000 40011000 04008008 00800000 00000000 00080008 00000000 00000000 02402000 00000001 00000000 10000a10 01000000 00000010 00000000 00000000 00000000 00000000 00000000 00040000 00020000 00000000 | 00010000 01000000 00000000 00000000 00482000 00000000 00000080 00000402 01000000 00108000 00000080 40001000 04028008 00800000 00000400 00090008 00000000 00000020 02412000 00000001 00000008 00000280 01008000 00000010 00200000 00000000 00404000 80000000 00000000 01000200 24020800 00000000 |