On Target TRY1_HUMAN 0.49019608/CHEMBL323543
For the given ligand GABAPENTIN, we have found in our database that, being scored 0.49019608, the most similar ligand is CHEMBL323543. Check out the elaboration below.
| GABAPENTIN (Given Ligand) | CHEMBL323543 (Similar Ligand) |
|---|---|
| NCC1(CC(=O)O)CCCCC1 | CC(=O)O.NC(=N)CCCC[C@@H]1[C@H]2CCC[C@@H]2OC1=O |
|
|
|
|
|
|
| 00030000 01000000 00000000 00000400 00180000 00000000 00000000 00000000 00000000 00000080 00000000 40011000 04008008 00800000 00000000 00080008 00000000 00000000 02402000 00000001 00000000 10000a10 01000000 00000010 00000000 00000000 00000000 00000000 00000000 00040000 00020000 00000000 | 00050040 01000000 00000100 00010f00 00080000 00000000 00000000 00002000 00000000 00000083 00010000 40019000 04008008 00800000 00080000 00081008 00820000 00000000 00402000 00000001 00000020 10010a10 01000000 00000010 00000400 00000000 40000000 00000000 00000200 01040002 00020000 00000000 |