On Target CDK5_HUMAN 0.296875/CHEMBL1994526
For the given ligand GABAPENTIN, we have found in our database that, being scored 0.296875, the most similar ligand is CHEMBL1994526. Check out the elaboration below.
| GABAPENTIN (Given Ligand) | CHEMBL1994526 (Similar Ligand) |
|---|---|
| NCC1(CC(=O)O)CCCCC1 | CC(N)C1CCC(CC1)C(=O)Nc2ccncc2 |
|
|
|
|
|
|
| 00030000 01000000 00000000 00000400 00180000 00000000 00000000 00000000 00000000 00000080 00000000 40011000 04008008 00800000 00000000 00080008 00000000 00000000 02402000 00000001 00000000 10000a10 01000000 00000010 00000000 00000000 00000000 00000000 00000000 00040000 00020000 00000000 | 00010002 01000000 00104000 00000600 20040000 00002000 00008000 00000000 00000000 000000c0 00280004 40011000 04008808 00100000 00020000 00040004 00040000 00000000 02202000 00000001 40100000 18048610 20804000 00100010 00000000 00000000 00008000 10000080 00000000 00060001 00020000 00000240 |