On Target 5HT2B_HUMAN 0.42307693/CHEMBL1123
For the given ligand GABAPENTIN, we have found in our database that, being scored 0.42307693, the most similar ligand is CHEMBL1123. Check out the elaboration below.
| GABAPENTIN (Given Ligand) | CHEMBL1123 (Similar Ligand) |
|---|---|
| NCC1(CC(=O)O)CCCCC1 | CCN(CC)CCOC(=O)C1(CCCCC1)C2CCCCC2 |
|
|
|
|
|
|
| 00030000 01000000 00000000 00000400 00180000 00000000 00000000 00000000 00000000 00000080 00000000 40011000 04008008 00800000 00000000 00080008 00000000 00000000 02402000 00000001 00000000 10000a10 01000000 00000010 00000000 00000000 00000000 00000000 00000000 00040000 00020000 00000000 | 00010000 01000000 00000200 80010700 00080080 00000000 00000000 00000000 00000000 00000000 00200000 40009000 0400800a 00800000 00001008 00081008 10860000 00000000 02402000 00000001 00000020 00000a00 13000000 00000010 10000400 00000000 00000000 00000001 00000200 00040000 00020000 00000200 |