On Target HRH1_HUMAN 0.29069766/CHEMBL1276859
For the given ligand GABAPENTIN, we have found in our database that, being scored 0.29069766, the most similar ligand is CHEMBL1276859. Check out the elaboration below.
| GABAPENTIN (Given Ligand) | CHEMBL1276859 (Similar Ligand) |
|---|---|
| NCC1(CC(=O)O)CCCCC1 | OC(=O)CC1CCN(C1)C2CC[C@@]3(C2)Cc4ccccc4Cc5ccccc35 |
|
|
|
|
|
|
| 00030000 01000000 00000000 00000400 00180000 00000000 00000000 00000000 00000000 00000080 00000000 40011000 04008008 00800000 00000000 00080008 00000000 00000000 02402000 00000001 00000000 10000a10 01000000 00000010 00000000 00000000 00000000 00000000 00000000 00040000 00020000 00000000 | 00030000 01000200 00100102 00010600 00180000 00000012 00000400 21000001 04100800 000808c0 08300000 40019000 04008012 01200000 00000020 020c0008 00000000 02000000 00502000 00000201 00000100 18100a10 01404000 00500810 00000000 a0000001 00000000 50000000 02000082 0106000a 00020000 00802f00 |