On Target GRM5_HUMAN 0.18018018/CHEMBL380626
For the given ligand NAPQI, we have found in our database that, being scored 0.18018018, the most similar ligand is CHEMBL380626. Check out the elaboration below.
| NAPQI (Given Ligand) | CHEMBL380626 (Similar Ligand) |
|---|---|
| CC(=O)N=c1ccc(=O)cc1 | CN1CCC/C/1=N\C(=O)Nc2cccc(Cl)c2 |
|
|
|
|
|
|
| 00000000 00000000 00200000 00080400 00000000 00000000 10000000 12000402 01000020 00100003 00000000 40000001 00008000 00000000 00000000 00000080 00000800 00000000 00110000 00008040 00000001 20001680 00008000 00000810 00000000 00000000 40401000 00400800 00000010 00040000 06000000 00020000 | 00008042 00000001 00100000 02000e00 22000020 00000010 18000000 00006003 00000200 001008c3 10290024 40008800 02008006 01100019 00001840 00500000 00040800 00000000 08000000 20004001 40102001 18000500 20002008 00001810 00902210 00000000 40001000 900000c0 00008010 00060001 06000000 00024200 |