On Target HRH1_HUMAN 0.1328125/CHEMBL1278021
For the given ligand NAPQI, we have found in our database that, being scored 0.1328125, the most similar ligand is CHEMBL1278021. Check out the elaboration below.
| NAPQI (Given Ligand) | CHEMBL1278021 (Similar Ligand) |
|---|---|
| CC(=O)N=c1ccc(=O)cc1 | OC(=O)C1=CCCN(C1)C2CC[C@]3(C2)Cc4ccccc4Cc5ccccc35 |
|
|
|
|
|
|
| 00000000 00000000 00200000 00080400 00000000 00000000 10000000 12000402 01000020 00100003 00000000 40000001 00008000 00000000 00000000 00000080 00000800 00000000 00110000 00008040 00000001 20001680 00008000 00000810 00000000 00000000 40401000 00400800 00000010 00040000 06000000 00020000 | 00000010 09008200 00100102 00010600 00000000 00000002 00180500 31000401 05100800 001808c8 08300000 40019000 08008102 00210000 00000020 020c0008 20000000 02000140 00912012 00000201 00000100 18100a90 0140c080 00500810 00001001 a0000401 00480000 50000000 02000082 0106040a 04020000 02002700 |