On Target HYES_HUMAN 0.75342464/CHEMBL1507203
For the given ligand Spiro[4.5]decan-8-yl analogue 14, we have found in our database that, being scored 0.75342464, the most similar ligand is CHEMBL1507203. Check out the elaboration below.
| Spiro[4.5]decan-8-yl analogue 14 (Given Ligand) | CHEMBL1507203 (Similar Ligand) |
|---|---|
| O=C(N[C@H]2CC[C@]1(CCCC1)CC2)c4ccc(c3ccccc3)cc4 | Cc1ccc(cc1)C(=O)N2CCC(CC2)C(=O)NC3CCCCCC3 |
|
|
|
|
|
|
| 00002000 01001800 00100100 40010600 00000000 00000000 00000000 22001000 00000100 000008c0 00200000 40018000 80008802 00000000 00000400 00000000 00020000 02000000 06002000 10000201 00000000 18068610 10000000 0050001c 00000000 c0000000 00000000 90000040 00004100 01060001 a0060000 00000200 | 00020000 01001800 00100100 40010600 00000000 00000000 00000000 22001000 00200100 000008c0 00200000 50039000 84008802 00000000 00000400 00000000 00000000 02000000 00002000 00000201 00000000 18068610 00000000 0050001c 00000000 c0000000 00000000 90001000 00000100 00060001 a0060000 00802200 |