On Target ACM1_HUMAN 0.6547619/CHEMBL3600801
For the given ligand Spiro[4.5]decan-8-yl analogue 14, we have found in our database that, being scored 0.6547619, the most similar ligand is CHEMBL3600801. Check out the elaboration below.
| Spiro[4.5]decan-8-yl analogue 14 (Given Ligand) | CHEMBL3600801 (Similar Ligand) |
|---|---|
| O=C(N[C@H]2CC[C@]1(CCCC1)CC2)c4ccc(c3ccccc3)cc4 | Clc1ccc(cc1)c2ccc(cc2)C(=O)NCCc3ccc(CN4CCCC4)cc3 |
|
|
|
|
|
|
| 00002000 01001800 00100100 40010600 00000000 00000000 00000000 22001000 00000100 000008c0 00200000 40018000 80008802 00000000 00000400 00000000 00020000 02000000 06002000 10000201 00000000 18068610 10000000 0050001c 00000000 c0000000 00000000 90000040 00004100 01060001 a0060000 00000200 | 0000a000 00001800 00100100 40010600 00000000 00000010 00000000 22001004 00000180 000808c0 08200000 40008800 82008806 00000000 00000400 00000000 00020000 02000000 04000000 10000201 00000000 18228700 10000000 8140001c 00002000 c0000000 00040000 90000040 04004100 00060003 a0040000 01020600 |