On Target FYN_HUMAN 0.54320985/CHEMBL1968394
For the given ligand Spiro[4.5]decan-8-yl analogue 14, we have found in our database that, being scored 0.54320985, the most similar ligand is CHEMBL1968394. Check out the elaboration below.
| Spiro[4.5]decan-8-yl analogue 14 (Given Ligand) | CHEMBL1968394 (Similar Ligand) |
|---|---|
| O=C(N[C@H]2CC[C@]1(CCCC1)CC2)c4ccc(c3ccccc3)cc4 | Cc1cccc(c1)c2ccc3CNC(=O)c3c2 |
|
|
|
|
|
|
| 00002000 01001800 00100100 40010600 00000000 00000000 00000000 22001000 00000100 000008c0 00200000 40018000 80008802 00000000 00000400 00000000 00020000 02000000 06002000 10000201 00000000 18068610 10000000 0050001c 00000000 c0000000 00000000 90000040 00004100 01060001 a0060000 00000200 | 00002000 00800800 00000100 10010600 00000001 04008000 10000000 02001000 00000100 00000840 00200000 40008000 80008802 00200000 00000400 08000008 00022000 02001000 04000000 10000000 80000000 08028680 10000000 0040000c 00000000 c0200000 08000000 80000041 10004100 00060001 80040000 00000200 |