On Target TRPV1_RAT 0.5168539/CHEMBL86708
For the given ligand Compound-103, we have found in our database that, being scored 0.5168539, the most similar ligand is CHEMBL86708. Check out the elaboration below.
| Compound-103 (Given Ligand) | CHEMBL86708 (Similar Ligand) |
|---|---|
| O=C(N[C@@H]2CC[C@]1(CCCC1)CC2)c4ccc(c3ccccc3)cc4 | CCCCCCCCCC(=O)NCc1ccc(O)c(OC)c1 |
|
|
|
|
|
|
| 00002000 01001800 00100100 40010600 00000000 00000000 00000000 22001000 00000100 000008c0 00200000 40018000 80008802 00000000 00000400 00000000 00020000 02000000 06002000 10000201 00000000 18068610 10000000 0050001c 00000000 c0000000 00000000 90000040 00004100 01060001 a0060000 00000200 | 00010000 45800008 20100108 00010600 00001000 00000000 02000000 22001000 00000000 000008c0 00200000 40019000 0400c80a 00000000 01000401 00008008 00000000 02000000 00082000 00020201 80000000 18008610 00000000 00548018 00000000 c0000000 00220000 90000000 00000300 00060001 20060000 00000200 |