On Target HPGDS_HUMAN 0.5/CHEMBL2035650
For the given ligand Compound-103, we have found in our database that, being scored 0.5, the most similar ligand is CHEMBL2035650. Check out the elaboration below.
| Compound-103 (Given Ligand) | CHEMBL2035650 (Similar Ligand) |
|---|---|
| O=C(N[C@@H]2CC[C@]1(CCCC1)CC2)c4ccc(c3ccccc3)cc4 | FC(F)(F)CN1CCC(CC1)NC(=O)c2ccc(nc2)c3ccccc3 |
|
|
|
|
|
|
| 00002000 01001800 00100100 40010600 00000000 00000000 00000000 22001000 00000100 000008c0 00200000 40018000 80008802 00000000 00000400 00000000 00020000 02000000 06002000 10000201 00000000 18068610 10000000 0050001c 00000000 c0000000 00000000 90000040 00004100 01060001 a0060000 00000200 | 10002002 01809c00 00104100 50010610 00041020 00000040 00004000 22081000 00000100 900009f0 01200004 50018000 80008802 00400000 00020480 02040004 00020000 02002004 04200000 10400201 c1000000 180c8e00 30800000 0070011c 00040000 c0000000 08000040 90000040 00404104 00060411 a0000800 80000200 |