On Target ALDR_HUMAN 0.37878788/CHEMBL4071420
For the given ligand Compound-103, we have found in our database that, being scored 0.37878788, the most similar ligand is CHEMBL4071420. Check out the elaboration below.
| Compound-103 (Given Ligand) | CHEMBL4071420 (Similar Ligand) |
|---|---|
| O=C(N[C@@H]2CC[C@]1(CCCC1)CC2)c4ccc(c3ccccc3)cc4 | Oc1ccc(CCCCNC(=O)C2=Cc3ccc(O)cc3OC2=O)cc1 |
|
|
|
|
|
|
| 00002000 01001800 00100100 40010600 00000000 00000000 00000000 22001000 00000100 000008c0 00200000 40018000 80008802 00000000 00000400 00000000 00020000 02000000 06002000 10000201 00000000 18068610 10000000 0050001c 00000000 c0000000 00000000 90000040 00004100 01060001 a0060000 00000200 | 00000000 01205808 20180102 00010600 00040213 00400120 02010000 62001210 02184801 400808c0 08300020 40418400 40008c03 00200080 00004480 20000008 00000000 02010040 08000000 00020201 00000100 1a06860a 00000008 0058001c 08000024 c0004000 00920010 98900000 02002100 01060803 e0040000 00000600 |