On Target AOFB_HUMAN 0.49074075/CHEMBL1814072
For the given ligand Compound-103, we have found in our database that, being scored 0.49074075, the most similar ligand is CHEMBL1814072. Check out the elaboration below.
| Compound-103 (Given Ligand) | CHEMBL1814072 (Similar Ligand) |
|---|---|
| O=C(N[C@@H]2CC[C@]1(CCCC1)CC2)c4ccc(c3ccccc3)cc4 | O=C(NC1CCCCC1)C2=COc3ccccc3C2=O |
|
|
|
|
|
|
| 00002000 01001800 00100100 40010600 00000000 00000000 00000000 22001000 00000100 000008c0 00200000 40018000 80008802 00000000 00000400 00000000 00020000 02000000 06002000 10000201 00000000 18068610 10000000 0050001c 00000000 c0000000 00000000 90000040 00004100 01060001 a0060000 00000200 | 00000000 01205800 00180100 00010600 00000203 80000120 00010000 62001210 02004001 400008c0 00200020 40018400 40008c03 00200088 00004400 20000000 00000000 02010000 02002000 00000201 00000000 1a06861a 00000000 0058001c 08000024 c0004000 00800010 98900000 00002100 01860001 e0040000 00000200 |