On Target PGH1_SHEEP 0.5/CHEMBL268643
For the given ligand Compound-103, we have found in our database that, being scored 0.5, the most similar ligand is CHEMBL268643. Check out the elaboration below.
| Compound-103 (Given Ligand) | CHEMBL268643 (Similar Ligand) |
|---|---|
| O=C(N[C@@H]2CC[C@]1(CCCC1)CC2)c4ccc(c3ccccc3)cc4 | O=C1NCCCC1N2C(=O)c3ccccc3C2=O |
|
|
|
|
|
|
| 00002000 01001800 00100100 40010600 00000000 00000000 00000000 22001000 00000100 000008c0 00200000 40018000 80008802 00000000 00000400 00000000 00020000 02000000 06002000 10000201 00000000 18068610 10000000 0050001c 00000000 c0000000 00000000 90000040 00004100 01060001 a0060000 00000200 | 00018000 01803800 00100100 14010600 00000000 00008000 00000080 22001008 00200000 000108c0 00200000 5003b000 06008812 00202000 00000400 00000000 00002000 02000000 00100000 00000201 80020000 38068680 00000001 0240001c 00000000 c0200000 00004000 90000000 08000100 00060001 a0044000 00000200 |