On Target CNR1_HUMAN 0.61702126/CHEMBL3397448
For the given ligand Compound-103, we have found in our database that, being scored 0.61702126, the most similar ligand is CHEMBL3397448. Check out the elaboration below.
| Compound-103 (Given Ligand) | CHEMBL3397448 (Similar Ligand) |
|---|---|
| O=C(N[C@@H]2CC[C@]1(CCCC1)CC2)c4ccc(c3ccccc3)cc4 | COc1c(C)cc(cc1C(=O)NC2CCCCCC2)c3ccccc3 |
|
|
|
|
|
|
| 00002000 01001800 00100100 40010600 00000000 00000000 00000000 22001000 00000100 000008c0 00200000 40018000 80008802 00000000 00000400 00000000 00020000 02000000 06002000 10000201 00000000 18068610 10000000 0050001c 00000000 c0000000 00000000 90000040 00004100 01060001 a0060000 00000200 | 00002000 01001808 20100108 00010600 00001001 04020100 12040000 22001400 00000000 001008c0 08200000 40018000 00008812 00000000 01000401 08002008 00020000 02001000 04002000 00020201 00000000 18068610 10000000 0050001c 00000000 c0000000 08020800 90001041 10004300 00060001 a4060000 00000200 |