On Target NMDE2_HUMAN 0.45238096/CHEMBL3357785
For the given ligand Compound-103, we have found in our database that, being scored 0.45238096, the most similar ligand is CHEMBL3357785. Check out the elaboration below.
| Compound-103 (Given Ligand) | CHEMBL3357785 (Similar Ligand) |
|---|---|
| O=C(N[C@@H]2CC[C@]1(CCCC1)CC2)c4ccc(c3ccccc3)cc4 | C(NC1CCc2ccccc2CC1)c3ccccc3 |
|
|
|
|
|
|
| 00002000 01001800 00100100 40010600 00000000 00000000 00000000 22001000 00000100 000008c0 00200000 40018000 80008802 00000000 00000400 00000000 00020000 02000000 06002000 10000201 00000000 18068610 10000000 0050001c 00000000 c0000000 00000000 90000040 00004100 01060001 a0060000 00000200 | 00000000 01000200 00100102 00010600 00000000 00000002 00000000 22001001 00000800 000808c0 08300000 40008000 00000802 00200000 00000420 02040000 01000000 02000000 00002000 00000201 00000100 18008000 00004000 00400010 00000000 c0000001 00000000 90000000 00000102 0006000a 20060000 00000600 |