On Target P2RX3_HUMAN 0.41095892/CHEMBL3669697
For the given ligand Compound-103, we have found in our database that, being scored 0.41095892, the most similar ligand is CHEMBL3669697. Check out the elaboration below.
| Compound-103 (Given Ligand) | CHEMBL3669697 (Similar Ligand) |
|---|---|
| O=C(N[C@@H]2CC[C@]1(CCCC1)CC2)c4ccc(c3ccccc3)cc4 | CCNC(=O)c1ccc(cc1)C(=O)C2C(C(CC)CC)N(C(=O)C2=O)c3ccc(cc3)c4ccon4 |
|
|
|
|
|
|
| 00002000 01001800 00100100 40010600 00000000 00000000 00000000 22001000 00000100 000008c0 00200000 40018000 80008802 00000000 00000400 00000000 00020000 02000000 06002000 10000201 00000000 18068610 10000000 0050001c 00000000 c0000000 00000000 90000040 00004100 01060001 a0060000 00000200 | 00036002 01001a00 001a0102 62010601 20020000 00102090 00000000 22001000 04120900 000808c0 08390004 5001b800 8e00880a 00309040 80020460 00440004 00060200 02000001 0c002018 00000201 40902100 18068610 30802000 0058009c 00001800 c0000080 00000020 980000c1 0000c106 0006000b 80065000 40c02600 |