On Target OPRM_MOUSE 0.61627907/CHEMBL2051964
For the given ligand Compound-103, we have found in our database that, being scored 0.61627907, the most similar ligand is CHEMBL2051964. Check out the elaboration below.
| Compound-103 (Given Ligand) | CHEMBL2051964 (Similar Ligand) |
|---|---|
| O=C(N[C@@H]2CC[C@]1(CCCC1)CC2)c4ccc(c3ccccc3)cc4 | Cc1ccc(O)c(c1)C(=O)NC[C@]2(C)C[C@H](O)CC(C)(C)C2 |
|
|
|
|
|
|
| 00002000 01001800 00100100 40010600 00000000 00000000 00000000 22001000 00000100 000008c0 00200000 40018000 80008802 00000000 00000400 00000000 00020000 02000000 06002000 10000201 00000000 18068610 10000000 0050001c 00000000 c0000000 00000000 90000040 00004100 01060001 a0060000 00000200 | 00000000 01001808 20100100 00010600 00180001 00020000 12000000 22001400 00000000 001008c0 00200000 40018000 00008802 00800000 00000400 08082008 00000000 02000000 02402000 00020201 00000000 18068610 01000000 0050001c 00000000 c0000000 08020000 90000000 00000100 00060001 a4060000 00000a00 |