On Target SCN9A_HUMAN 0.5697674/CHEMBL2152694
For the given ligand Compound-103, we have found in our database that, being scored 0.5697674, the most similar ligand is CHEMBL2152694. Check out the elaboration below.
| Compound-103 (Given Ligand) | CHEMBL2152694 (Similar Ligand) |
|---|---|
| O=C(N[C@@H]2CC[C@]1(CCCC1)CC2)c4ccc(c3ccccc3)cc4 | CN(C)c1ccc(C(=O)NC2CC23CCN(CC3)c4ccccc4)c5ccccc15 |
|
|
|
|
|
|
| 00002000 01001800 00100100 40010600 00000000 00000000 00000000 22001000 00000100 000008c0 00200000 40018000 80008802 00000000 00000400 00000000 00020000 02000000 06002000 10000201 00000000 18068610 10000000 0050001c 00000000 c0000000 00000000 90000040 00004100 01060001 a0060000 00000200 | 00004002 01001800 00100100 80010600 20000000 00002000 00000000 22001000 00200000 000008c0 00200004 50038000 00008802 01008000 00020440 00000000 00040000 02000000 08000000 00000201 40100000 18068628 20000000 0050001c 00000000 c0000000 00000000 90000080 00008100 00060001 a0040000 00000200 |