On Target PGH2_HUMAN 0.47272727/CHEMBL148931
For the given ligand Compound-103, we have found in our database that, being scored 0.47272727, the most similar ligand is CHEMBL148931. Check out the elaboration below.
| Compound-103 (Given Ligand) | CHEMBL148931 (Similar Ligand) |
|---|---|
| O=C(N[C@@H]2CC[C@]1(CCCC1)CC2)c4ccc(c3ccccc3)cc4 | CCCCCCCCNC(=O)c1ccccc1Nc2c(Cl)ccc(C)c2Cl |
|
|
|
|
|
|
| 00002000 01001800 00100100 40010600 00000000 00000000 00000000 22001000 00000100 000008c0 00200000 40018000 80008802 00000000 00000400 00000000 00020000 02000000 06002000 10000201 00000000 18068610 10000000 0050001c 00000000 c0000000 00000000 90000040 00004100 01060001 a0060000 00000200 | 00008002 01001800 00100100 00010600 00000000 00110020 00000010 2a001040 00802000 000008d1 00210004 40018800 02008806 00000400 00020440 00000000 00040000 03000002 0800a002 00800201 41000000 18068710 20000000 0050001c 00042000 c0000600 02040000 90011080 00408108 00260001 a0060000 40020200 |