On Target TRY1_HUMAN 0.5478261/CHEMBL45106
For the given ligand Compound-103, we have found in our database that, being scored 0.5478261, the most similar ligand is CHEMBL45106. Check out the elaboration below.
| Compound-103 (Given Ligand) | CHEMBL45106 (Similar Ligand) |
|---|---|
| O=C(N[C@@H]2CC[C@]1(CCCC1)CC2)c4ccc(c3ccccc3)cc4 | COC(=O)[C@H](Cc1cccc(c1)C(=N)N)[C@@H](CC2CCCCC2)NC(=O)c3ccc(cc3)c4cccc(CN)c4 |
|
|
|
|
|
|
| 00002000 01001800 00100100 40010600 00000000 00000000 00000000 22001000 00000100 000008c0 00200000 40018000 80008802 00000000 00000400 00000000 00020000 02000000 06002000 10000201 00000000 18068610 10000000 0050001c 00000000 c0000000 00000000 90000040 00004100 01060001 a0060000 00000200 | 00012000 01001a08 00100102 40010700 00080001 04000000 00000000 22001000 00000900 000808c3 08300000 40019000 8c00880a 00a00000 00000400 000c0008 00a20000 02001001 06c02418 10000201 00000100 18168e10 110000c0 0050001c 00001801 c0000000 48000000 90000041 0000430a 0006000b e0060000 00000600 |