On Target 5HT2B_HUMAN 0.67045456/CHEMBL475245
For the given ligand Compound-103, we have found in our database that, being scored 0.67045456, the most similar ligand is CHEMBL475245. Check out the elaboration below.
| Compound-103 (Given Ligand) | CHEMBL475245 (Similar Ligand) |
|---|---|
| O=C(N[C@@H]2CC[C@]1(CCCC1)CC2)c4ccc(c3ccccc3)cc4 | O=C(N1CCC(Cc2ncc[nH]2)CC1)c3ccc(cc3)c4ccccc4 |
|
|
|
|
|
|
| 00002000 01001800 00100100 40010600 00000000 00000000 00000000 22001000 00000100 000008c0 00200000 40018000 80008802 00000000 00000400 00000000 00020000 02000000 06002000 10000201 00000000 18068610 10000000 0050001c 00000000 c0000000 00000000 90000040 00004100 01060001 a0060000 00000200 | 0000200a 01001800 00100500 50010600 00000040 00000000 01000000 22001000 00000100 000008c0 00208000 50018000 80008802 00000000 00020400 000c0004 00020000 06000000 04000008 10000201 00200000 18068600 31000000 0050001c 00000000 c0000000 00000000 900000c0 00004104 00c60801 e0040000 20000200 |