On Target PAR1_HUMAN 0.41216215/CHEMBL2049115
For the given ligand test, we have found in our database that, being scored 0.41216215, the most similar ligand is CHEMBL2049115. Check out the elaboration below.
| test (Given Ligand) | CHEMBL2049115 (Similar Ligand) |
|---|---|
| O=C(Nc1cc(Cl)ccc1O)c3cccc(S(=O)(=O)N2CCCCC2)c3 | CCCC(=O)Nc1cccc(NC(=O)c2cc(Cl)ccc2Br)c1 |
|
|
|
|
|
|
| 0000c012 01800809 21104100 01b10600 00080120 00010000 0a000000 02001000 01000000 004008c0 00282004 7001c800 02008806 00100001 806000c0 00004108 00042000 06000000 08410000 00026601 c0100000 18028700 20012000 1840801c 02002000 80000004 20100040 9000108c 00008500 20060001 80040000 40030270 | 0000c002 08008800 00100100 00010600 28000000 00002000 04000800 02001000 00000000 000008c8 00280004 4080d800 06008814 00100000 c0020440 00000000 00040000 02000000 08000000 20000001 40100000 18028700 20012000 00400014 00082000 80100000 80020400 90000080 00808100 00060801 a0040008 08020200 |