On Target AMPN_HUMAN 0.3207547/CHEMBL1828920
For the given ligand test, we have found in our database that, being scored 0.3207547, the most similar ligand is CHEMBL1828920. Check out the elaboration below.
| test (Given Ligand) | CHEMBL1828920 (Similar Ligand) |
|---|---|
| O=C(Nc1cc(Cl)ccc1O)c3cccc(S(=O)(=O)N2CCCCC2)c3 | CC[C@H](C)[C@H](NC(=O)CC(C)(C)C)C(=O)N1Cc2cc(OCC(=O)NO)ccc2C[C@H]1C(=O)Nc3ccc(OC)cc3 |
|
|
|
|
|
|
| 0000c012 01800809 21104100 01b10600 00080120 00010000 0a000000 02001000 01000000 004008c0 00282004 7001c800 02008806 00100001 806000c0 00004108 00042000 06000000 08410000 00026601 c0100000 18028700 20012000 1840801c 02002000 80000004 20100040 9000108c 00008500 20060001 80040000 40030270 | 0401c00a 45803218 60100128 14010602 20001020 00002000 03040000 2200100c 00000880 00090ac0 083c0004 4001f000 068088a2 00302081 810214c1 020c0018 10040200 820000a0 08080008 00120201 c0120100 38248600 22006003 8354801a 00000800 c0000001 00164008 90000080 0c008300 0086000f 20044000 00002600 |