On Target CHLE_HUMAN 0.44805196/CHEMBL4105611
For the given ligand test, we have found in our database that, being scored 0.44805196, the most similar ligand is CHEMBL4105611. Check out the elaboration below.
| test (Given Ligand) | CHEMBL4105611 (Similar Ligand) |
|---|---|
| O=C(Nc1cc(Cl)ccc1O)c3cccc(S(=O)(=O)N2CCCCC2)c3 | COCCN(CC1CCCN(Cc2ccccc2)C1)S(=O)(=O)c3ccc4ccccc4c3 |
|
|
|
|
|
|
| 0000c012 01800809 21104100 01b10600 00080120 00010000 0a000000 02001000 01000000 004008c0 00282004 7001c800 02008806 00100001 806000c0 00004108 00042000 06000000 08410000 00026601 c0100000 18028700 20012000 1840801c 02002000 80000004 20100040 9000108c 00008500 20060001 80040000 40030270 | 00000010 01800400 01100100 01b10600 000800c0 00000000 00000000 22001000 00040000 004009e0 00202000 70018000 00000802 00000001 80e81400 00080008 10002000 02000000 00400000 08007603 80000000 18008028 12100000 58500058 02000020 c000000c 00000000 9000000d 00000700 20060010 20040000 00012270 |