On Target PDE4B_HUMAN 0.4491018/CHEMBL576479
For the given ligand test, we have found in our database that, being scored 0.4491018, the most similar ligand is CHEMBL576479. Check out the elaboration below.
| test (Given Ligand) | CHEMBL576479 (Similar Ligand) |
|---|---|
| O=C(Nc1cc(Cl)ccc1O)c3cccc(S(=O)(=O)N2CCCCC2)c3 | COc1cccc(Nc2c(cnc3ccc(cc23)S(=O)(=O)N(C)C)C(=O)N)c1 |
|
|
|
|
|
|
| 0000c012 01800809 21104100 01b10600 00080120 00010000 0a000000 02001000 01000000 004008c0 00282004 7001c800 02008806 00100001 806000c0 00004108 00042000 06000000 08410000 00026601 c0100000 18028700 20012000 1840801c 02002000 80000004 20100040 9000108c 00008500 20060001 80040000 40030270 | 00000012 8080a808 21004108 00b10610 00041010 00010000 0200c010 00001048 00802000 00000840 01302004 60008000 00008802 08400001 816200c1 0004000c 00042000 02000004 08608002 00826c01 c0000000 08068608 20800000 8840000c 00040000 80000100 0a008000 000110cc 00408600 20260000 80040000 c0030060 |